CAS 1142202-84-3

1-[[4-(Ethoxycarbonyl)-3,5-dimethyl-1H-pyrrol-2-yl]carbonyl]-4-piperidineacetic acid

Description:

1-[[4-(Ethoxycarbonyl)-3,5-dimethyl-1H-pyrrol-2-yl]carbonyl]-4-piperidineacetic acid is a complex organic compound characterized by its multi-functional structure, which includes a piperidine ring and a pyrrole moiety. The presence of the ethoxycarbonyl group suggests that it has ester functionalities, contributing to its potential solubility in organic solvents. The compound features multiple functional groups, including carboxylic acid and carbonyl groups, which may impart acidic properties and reactivity in various chemical reactions. Its molecular structure indicates potential applications in medicinal chemistry, particularly in drug design, due to the presence of heterocycles that can interact with biological targets. The compound's stability, reactivity, and solubility can be influenced by the substituents on the pyrrole and piperidine rings, making it a candidate for further investigation in pharmaceutical research. Overall, this compound exemplifies the complexity and diversity of organic molecules used in various chemical applications.

Formula: C₁₇H₂₄N₂O₅

InChI: InChI=1S/C17H24N2O5/c1-4-24-17(23)14-10(2)15(18-11(14)3)16(22)19-7-5-12(6-8-19)9-13(20)21/h12,18H,4-9H2,1-3H3,(H,20,21)

InChI key: InChIKey=VAXZZRPJIAZVHL-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C)C(C(OCC)=O)=C(C)N1)N2CCC(CC(O)=O)CC2

Synonyms:

• 4-Piperidineacetic acid, 1-[[4-(ethoxycarbonyl)-3,5-dimethyl-1H-pyrrol-2-yl]carbonyl]-
• 1-[[4-(Ethoxycarbonyl)-3,5-dimethyl-1H-pyrrol-2-yl]carbonyl]-4-piperidineacetic acid