
CAS 1142204-34-9
:N-[2-[[2-(2-Chlorophenyl)ethyl]amino]-2-oxoethyl]-N-(4-methoxyphenyl)glycine
Description:
N-[2-[[2-(2-Chlorophenyl)ethyl]amino]-2-oxoethyl]-N-(4-methoxyphenyl)glycine, with CAS number 1142204-34-9, is a synthetic compound that belongs to the class of amino acids and derivatives. This substance features a complex structure characterized by the presence of a glycine backbone, which is modified by the addition of a 2-(2-chlorophenyl)ethyl amino group and a methoxyphenyl substituent. The presence of the chlorophenyl group suggests potential interactions with biological targets, possibly influencing its pharmacological properties. The methoxy group may enhance lipophilicity, affecting the compound's solubility and permeability. This compound is of interest in medicinal chemistry, particularly in the development of therapeutic agents, due to its potential biological activity. Its specific characteristics, such as melting point, solubility, and stability, would depend on the conditions under which it is studied. As with many synthetic compounds, safety and handling precautions are essential, and its effects on biological systems would require thorough investigation through pharmacological studies.
Formula:C19H21ClN2O4
InChI:InChI=1S/C19H21ClN2O4/c1-26-16-8-6-15(7-9-16)22(13-19(24)25)12-18(23)21-11-10-14-4-2-3-5-17(14)20/h2-9H,10-13H2,1H3,(H,21,23)(H,24,25)
InChI key:InChIKey=CQPMTEMXBWYNRA-UHFFFAOYSA-N
SMILES:N(CC(NCCC1=C(Cl)C=CC=C1)=O)(CC(O)=O)C2=CC=C(OC)C=C2
Synonyms:- Glycine, N-[2-[[2-(2-chlorophenyl)ethyl]amino]-2-oxoethyl]-N-(4-methoxyphenyl)-
- N-[2-[[2-(2-Chlorophenyl)ethyl]amino]-2-oxoethyl]-N-(4-methoxyphenyl)glycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.