
CAS 1142204-45-2
:N-[2-[[(2,4-Dichlorophenyl)methyl]amino]-2-oxoethyl]-N-(4-methoxyphenyl)glycine
Description:
N-[2-[[(2,4-Dichlorophenyl)methyl]amino]-2-oxoethyl]-N-(4-methoxyphenyl)glycine, identified by its CAS number 1142204-45-2, is a synthetic compound that belongs to the class of amino acids and derivatives. This substance features a complex structure characterized by the presence of a glycine backbone, which is modified by the addition of a dichlorophenylmethyl group and a methoxyphenyl group. The dichlorophenyl moiety contributes to its potential biological activity, while the methoxy group may influence its solubility and reactivity. The compound is likely to exhibit polar characteristics due to the presence of the amino and carboxyl functional groups, which can engage in hydrogen bonding. Its unique structure suggests potential applications in pharmaceuticals, particularly in the development of therapeutic agents. However, specific properties such as solubility, melting point, and biological activity would require empirical investigation to fully characterize its behavior in various environments.
Formula:C18H18Cl2N2O4
InChI:InChI=1S/C18H18Cl2N2O4/c1-26-15-6-4-14(5-7-15)22(11-18(24)25)10-17(23)21-9-12-2-3-13(19)8-16(12)20/h2-8H,9-11H2,1H3,(H,21,23)(H,24,25)
InChI key:InChIKey=ORXJCMHSDJTIBU-UHFFFAOYSA-N
SMILES:N(CC(NCC1=C(Cl)C=C(Cl)C=C1)=O)(CC(O)=O)C2=CC=C(OC)C=C2
Synonyms:- Glycine, N-[2-[[(2,4-dichlorophenyl)methyl]amino]-2-oxoethyl]-N-(4-methoxyphenyl)-
- N-[2-[[(2,4-Dichlorophenyl)methyl]amino]-2-oxoethyl]-N-(4-methoxyphenyl)glycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.