
CAS 1142204-47-4
:N-[2-[[(3,4-Dichlorophenyl)methyl]amino]-2-oxoethyl]-N-(4-methoxyphenyl)glycine
Description:
N-[2-[[(3,4-Dichlorophenyl)methyl]amino]-2-oxoethyl]-N-(4-methoxyphenyl)glycine, with CAS number 1142204-47-4, is a synthetic compound that belongs to the class of amino acids and derivatives. This substance features a glycine backbone modified with a dichlorophenylmethylamino group and a methoxyphenyl substituent, which contributes to its unique chemical properties. The presence of the dichlorophenyl group suggests potential applications in pharmaceuticals, particularly in the development of compounds with biological activity, such as anti-inflammatory or analgesic effects. The methoxy group may enhance lipophilicity, influencing the compound's solubility and permeability. Additionally, the oxoethyl moiety indicates the potential for reactivity, possibly allowing for further chemical modifications. Overall, this compound's structure suggests it may exhibit interesting pharmacological properties, although specific biological activities would require empirical investigation to confirm its efficacy and safety in potential applications.
Formula:C18H18Cl2N2O4
InChI:InChI=1S/C18H18Cl2N2O4/c1-26-14-5-3-13(4-6-14)22(11-18(24)25)10-17(23)21-9-12-2-7-15(19)16(20)8-12/h2-8H,9-11H2,1H3,(H,21,23)(H,24,25)
InChI key:InChIKey=CKEOIDCQRJEWGE-UHFFFAOYSA-N
SMILES:N(CC(NCC1=CC(Cl)=C(Cl)C=C1)=O)(CC(O)=O)C2=CC=C(OC)C=C2
Synonyms:- N-[2-[[(3,4-Dichlorophenyl)methyl]amino]-2-oxoethyl]-N-(4-methoxyphenyl)glycine
- Glycine, N-[2-[[(3,4-dichlorophenyl)methyl]amino]-2-oxoethyl]-N-(4-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.