CAS 1142204-50-9
:N-[2-(Cycloheptylamino)-2-oxoethyl]-N-(4-methoxyphenyl)glycine
Description:
N-[2-(Cycloheptylamino)-2-oxoethyl]-N-(4-methoxyphenyl)glycine is a chemical compound characterized by its unique structure, which includes a glycine backbone modified with a cycloheptylamino group and a methoxyphenyl substituent. This compound features both amine and carboxylic acid functional groups, contributing to its potential as a zwitterionic species. The presence of the cycloheptyl ring introduces steric bulk, which may influence its biological activity and solubility. The methoxy group on the phenyl ring can enhance lipophilicity, potentially affecting the compound's interaction with biological membranes and receptors. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its specific applications and behavior in biological systems would depend on its interactions at the molecular level, including binding affinities and metabolic stability. Overall, N-[2-(Cycloheptylamino)-2-oxoethyl]-N-(4-methoxyphenyl)glycine represents a complex structure with potential implications in drug design and development.
Formula:C18H26N2O4
InChI:InChI=1S/C18H26N2O4/c1-24-16-10-8-15(9-11-16)20(13-18(22)23)12-17(21)19-14-6-4-2-3-5-7-14/h8-11,14H,2-7,12-13H2,1H3,(H,19,21)(H,22,23)
InChI key:InChIKey=BYGKRAAOGMUIJK-UHFFFAOYSA-N
SMILES:N(CC(NC1CCCCCC1)=O)(CC(O)=O)C2=CC=C(OC)C=C2
Synonyms:- Glycine, N-[2-(cycloheptylamino)-2-oxoethyl]-N-(4-methoxyphenyl)-
- N-[2-(Cycloheptylamino)-2-oxoethyl]-N-(4-methoxyphenyl)glycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.