CAS 1142204-59-8
:N-[2-[[2-(4-Methoxyphenyl)ethyl]amino]-2-oxoethyl]-N-phenylglycine
Description:
N-[2-[[2-(4-Methoxyphenyl)ethyl]amino]-2-oxoethyl]-N-phenylglycine, with the CAS number 1142204-59-8, is a chemical compound that belongs to the class of amino acids and derivatives. This substance features a phenylglycine backbone, which is modified by the presence of a methoxyphenyl group and an ethylamino moiety. The structure indicates that it has both hydrophilic and hydrophobic characteristics, which may influence its solubility and interaction with biological systems. The presence of the methoxy group suggests potential for increased lipophilicity, while the amino and carboxyl functional groups contribute to its ability to participate in hydrogen bonding and ionic interactions. This compound may exhibit biological activity, potentially acting as a ligand or modulator in various biochemical pathways. Its specific applications and effects would depend on further studies, including pharmacological evaluations and toxicity assessments. Overall, the unique structural features of this compound make it of interest in medicinal chemistry and drug development.
Formula:C19H22N2O4
InChI:InChI=1S/C19H22N2O4/c1-25-17-9-7-15(8-10-17)11-12-20-18(22)13-21(14-19(23)24)16-5-3-2-4-6-16/h2-10H,11-14H2,1H3,(H,20,22)(H,23,24)
InChI key:InChIKey=YTSRAVLOLORVQS-UHFFFAOYSA-N
SMILES:N(CC(NCCC1=CC=C(OC)C=C1)=O)(CC(O)=O)C2=CC=CC=C2
Synonyms:- Glycine, N-[2-[[2-(4-methoxyphenyl)ethyl]amino]-2-oxoethyl]-N-phenyl-
- N-[2-[[2-(4-Methoxyphenyl)ethyl]amino]-2-oxoethyl]-N-phenylglycine
- [(2-{[2-(4-methoxyphenyl)ethyl]amino}-2-oxoethyl)(phenyl)amino]acetic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.