CAS 1142204-64-5

N-[2-[[(4-Fluorophenyl)methyl]amino]-2-oxoethyl]-N-phenylglycine

Description:

N-[2-[[(4-Fluorophenyl)methyl]amino]-2-oxoethyl]-N-phenylglycine, identified by its CAS number 1142204-64-5, is a synthetic organic compound characterized by its complex structure, which includes an amino acid derivative. This compound features a phenyl group and a fluorinated aromatic moiety, contributing to its potential biological activity. The presence of the 4-fluorophenyl group may influence its pharmacological properties, possibly enhancing lipophilicity or altering receptor interactions. The molecule contains both an amine and a carboxylic acid functional group, suggesting it may exhibit zwitterionic behavior in solution, which can affect its solubility and stability. Its unique structure may make it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, the compound's synthesis and characterization would typically involve standard organic chemistry techniques, including chromatography and spectroscopy, to confirm its purity and structural integrity. Overall, this compound represents a class of molecules that may have significant implications in drug discovery and development.

Formula: C₁₇H₁₇FN₂O₃

InChI: InChI=1S/C17H17FN2O3/c18-14-8-6-13(7-9-14)10-19-16(21)11-20(12-17(22)23)15-4-2-1-3-5-15/h1-9H,10-12H2,(H,19,21)(H,22,23)

InChI key: InChIKey=UHSLMTSQZZIWFI-UHFFFAOYSA-N

SMILES: N(CC(NCC1=CC=C(F)C=C1)=O)(CC(O)=O)C2=CC=CC=C2

Synonyms:

• Glycine, N-[2-[[(4-fluorophenyl)methyl]amino]-2-oxoethyl]-N-phenyl-
• N-[2-[[(4-Fluorophenyl)methyl]amino]-2-oxoethyl]-N-phenylglycine