CymitQuimica logo

CAS 1142204-68-9

:

N-[2-[(2-Furanylmethyl)amino]-2-oxoethyl]-N-phenylglycine

Description:
N-[2-[(2-Furanylmethyl)amino]-2-oxoethyl]-N-phenylglycine is a chemical compound characterized by its unique structure, which includes a phenyl group, a glycine moiety, and a furan ring. This compound features an amino group that is linked to a furan-derived substituent, contributing to its potential biological activity. The presence of the furan ring suggests that it may exhibit interesting reactivity and could participate in various chemical reactions, such as electrophilic substitutions or cycloadditions. The compound's structure indicates that it may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both amino and carboxylic acid functionalities, which can facilitate interactions with biological targets. Additionally, the compound's molecular characteristics may influence its solubility, stability, and bioavailability, making it a subject of interest for further research in drug design and development. Overall, N-[2-[(2-Furanylmethyl)amino]-2-oxoethyl]-N-phenylglycine represents a complex organic molecule with potential implications in various chemical and biological fields.
Formula:C15H16N2O4
InChI:InChI=1S/C15H16N2O4/c18-14(16-9-13-7-4-8-21-13)10-17(11-15(19)20)12-5-2-1-3-6-12/h1-8H,9-11H2,(H,16,18)(H,19,20)
InChI key:InChIKey=DUVAZEKEUADJEQ-UHFFFAOYSA-N
SMILES:N(CC(NCC1=CC=CO1)=O)(CC(O)=O)C2=CC=CC=C2
Synonyms:
  • N-[2-[(2-Furanylmethyl)amino]-2-oxoethyl]-N-phenylglycine
  • Glycine, N-[2-[(2-furanylmethyl)amino]-2-oxoethyl]-N-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.