CAS 1142204-70-3
:N-[2-Oxo-2-[[(tetrahydro-2-furanyl)methyl]amino]ethyl]-N-phenylglycine
Description:
N-[2-Oxo-2-[[(tetrahydro-2-furanyl)methyl]amino]ethyl]-N-phenylglycine, identified by its CAS number 1142204-70-3, is a synthetic compound that features a complex structure incorporating both amino acid and furan moieties. This substance is characterized by the presence of a phenyl group, which contributes to its aromatic properties, and a tetrahydrofuran ring, which enhances its solubility and reactivity. The molecule contains a ketone functional group, indicated by the "2-oxo" designation, which plays a crucial role in its chemical behavior, potentially influencing its reactivity and interactions with biological systems. The presence of the amino group suggests that it may participate in hydrogen bonding, making it relevant in various chemical and biological contexts. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. However, specific biological activities and applications would require further investigation through empirical studies.
Formula:C15H20N2O4
InChI:InChI=1S/C15H20N2O4/c18-14(16-9-13-7-4-8-21-13)10-17(11-15(19)20)12-5-2-1-3-6-12/h1-3,5-6,13H,4,7-11H2,(H,16,18)(H,19,20)
InChI key:InChIKey=XWPPZCOBSONQEA-UHFFFAOYSA-N
SMILES:N(CC(NCC1CCCO1)=O)(CC(O)=O)C2=CC=CC=C2
Synonyms:- Glycine, N-[2-oxo-2-[[(tetrahydro-2-furanyl)methyl]amino]ethyl]-N-phenyl-
- N-[2-Oxo-2-[[(tetrahydro-2-furanyl)methyl]amino]ethyl]-N-phenylglycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.