CymitQuimica logo

CAS 1142204-74-7

:

N-[2-[[2-(2-Fluorophenyl)ethyl]amino]-2-oxoethyl]-N-phenylglycine

Description:
N-[2-[[2-(2-Fluorophenyl)ethyl]amino]-2-oxoethyl]-N-phenylglycine, identified by its CAS number 1142204-74-7, is a synthetic compound that belongs to the class of amino acids and derivatives. This substance features a complex structure characterized by the presence of a phenyl group, a fluorinated aromatic ring, and an amino acid backbone. The fluorine atom in the 2-fluorophenyl moiety can influence the compound's biological activity and lipophilicity, potentially enhancing its pharmacological properties. The presence of the oxoethyl group suggests that it may participate in various chemical reactions, including those involving nucleophiles. This compound may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity would depend on the functional groups present and the overall molecular structure. As with many synthetic compounds, its safety profile and potential applications would require thorough investigation through experimental studies and toxicological assessments.
Formula:C18H19FN2O3
InChI:InChI=1S/C18H19FN2O3/c19-16-9-5-4-6-14(16)10-11-20-17(22)12-21(13-18(23)24)15-7-2-1-3-8-15/h1-9H,10-13H2,(H,20,22)(H,23,24)
InChI key:InChIKey=YGXUSIJOYNWZIQ-UHFFFAOYSA-N
SMILES:N(CC(NCCC1=C(F)C=CC=C1)=O)(CC(O)=O)C2=CC=CC=C2
Synonyms:
  • Glycine, N-[2-[[2-(2-fluorophenyl)ethyl]amino]-2-oxoethyl]-N-phenyl-
  • N-[2-[[2-(2-Fluorophenyl)ethyl]amino]-2-oxoethyl]-N-phenylglycine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.