CAS 1142204-81-6
:N-[2-[[(2,3-Dimethoxyphenyl)methyl]amino]-2-oxoethyl]-N-phenylglycine
Description:
N-[2-[[(2,3-Dimethoxyphenyl)methyl]amino]-2-oxoethyl]-N-phenylglycine, identified by its CAS number 1142204-81-6, is a chemical compound that belongs to the class of amino acids and derivatives. This substance features a complex structure characterized by the presence of a phenyl group, a dimethoxyphenyl moiety, and an amino acid backbone. Its molecular structure suggests potential interactions with biological systems, particularly in the context of pharmacology, where it may exhibit properties related to neurotransmitter modulation or receptor activity. The dimethoxy substitution on the aromatic ring can influence its lipophilicity and bioavailability, while the amino and carboxylic functional groups contribute to its solubility and reactivity. As with many compounds in this class, it may be of interest in medicinal chemistry for its potential therapeutic applications. However, specific biological activity, toxicity, and pharmacokinetic properties would require further investigation through empirical studies.
Formula:C19H22N2O5
InChI:InChI=1S/C19H22N2O5/c1-25-16-10-6-7-14(19(16)26-2)11-20-17(22)12-21(13-18(23)24)15-8-4-3-5-9-15/h3-10H,11-13H2,1-2H3,(H,20,22)(H,23,24)
InChI key:InChIKey=LHJXSHJPAPMUSA-UHFFFAOYSA-N
SMILES:C(NC(CN(CC(O)=O)C1=CC=CC=C1)=O)C2=C(OC)C(OC)=CC=C2
Synonyms:- Glycine, N-[2-[[(2,3-dimethoxyphenyl)methyl]amino]-2-oxoethyl]-N-phenyl-
- N-[2-[[(2,3-Dimethoxyphenyl)methyl]amino]-2-oxoethyl]-N-phenylglycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.