CAS 1142204-83-8
:N-[2-[[(2-Fluorophenyl)methyl]amino]-2-oxoethyl]-N-phenylglycine
Description:
N-[2-[[(2-Fluorophenyl)methyl]amino]-2-oxoethyl]-N-phenylglycine, with the CAS number 1142204-83-8, is a chemical compound that belongs to the class of amino acids and derivatives. This substance features a phenyl group and a fluorinated aromatic ring, which can influence its biological activity and solubility. The presence of the amino and carboxylic functional groups suggests that it may exhibit properties typical of amino acids, such as potential interactions with biological receptors or enzymes. The fluorine atom in the structure can enhance lipophilicity and metabolic stability, making it of interest in medicinal chemistry. Additionally, the compound's unique structure may contribute to specific pharmacological properties, potentially making it a candidate for drug development. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its behavior in biological systems would be assessed through various assays to determine its efficacy and safety profile. Overall, this compound represents a complex structure with potential applications in pharmaceuticals or biochemistry.
Formula:C17H17FN2O3
InChI:InChI=1S/C17H17FN2O3/c18-15-9-5-4-6-13(15)10-19-16(21)11-20(12-17(22)23)14-7-2-1-3-8-14/h1-9H,10-12H2,(H,19,21)(H,22,23)
InChI key:InChIKey=ZVWDZIRAQPOELO-UHFFFAOYSA-N
SMILES:N(CC(NCC1=C(F)C=CC=C1)=O)(CC(O)=O)C2=CC=CC=C2
Synonyms:- Glycine, N-[2-[[(2-fluorophenyl)methyl]amino]-2-oxoethyl]-N-phenyl-
- N-[2-[[(2-Fluorophenyl)methyl]amino]-2-oxoethyl]-N-phenylglycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.