CymitQuimica logo

CAS 1142204-84-9

:

N-[2-[[2-(3-Fluorophenyl)ethyl]amino]-2-oxoethyl]-N-phenylglycine

Description:
N-[2-[[2-(3-Fluorophenyl)ethyl]amino]-2-oxoethyl]-N-phenylglycine, with the CAS number 1142204-84-9, is a chemical compound that belongs to the class of amino acids and derivatives. It features a phenyl group and a fluorinated aromatic ring, which can influence its biological activity and properties. The presence of the amino and carboxylic functional groups suggests that it may exhibit characteristics typical of amino acids, such as solubility in polar solvents and potential for forming hydrogen bonds. The fluorine atom can enhance lipophilicity and metabolic stability, making it of interest in pharmaceutical applications. This compound may also exhibit specific interactions with biological targets, potentially influencing its pharmacological profile. Its structural complexity indicates that it could be involved in various biochemical pathways, making it a candidate for further research in medicinal chemistry and drug development. However, detailed studies would be necessary to fully elucidate its properties, including its reactivity, stability, and biological effects.
Formula:C18H19FN2O3
InChI:InChI=1S/C18H19FN2O3/c19-15-6-4-5-14(11-15)9-10-20-17(22)12-21(13-18(23)24)16-7-2-1-3-8-16/h1-8,11H,9-10,12-13H2,(H,20,22)(H,23,24)
InChI key:InChIKey=GCNZTVUJYSISKJ-UHFFFAOYSA-N
SMILES:N(CC(NCCC1=CC(F)=CC=C1)=O)(CC(O)=O)C2=CC=CC=C2
Synonyms:
  • N-[2-[[2-(3-Fluorophenyl)ethyl]amino]-2-oxoethyl]-N-phenylglycine
  • Glycine, N-[2-[[2-(3-fluorophenyl)ethyl]amino]-2-oxoethyl]-N-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.