CAS 1142204-85-0
:N-[2-Oxo-2-[(3-pyridinylmethyl)amino]ethyl]-N-phenylglycine
Description:
N-[2-Oxo-2-[(3-pyridinylmethyl)amino]ethyl]-N-phenylglycine, with the CAS number 1142204-85-0, is a synthetic compound characterized by its unique structure that includes a phenyl group, a glycine moiety, and a pyridinylmethyl substituent. This compound typically exhibits properties associated with both amino acids and small organic molecules, such as solubility in polar solvents and potential biological activity. The presence of the pyridine ring suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The oxo group contributes to its reactivity, potentially allowing for further chemical modifications. As a derivative of glycine, it may participate in various biochemical processes, and its structural features could influence its pharmacokinetic and pharmacodynamic properties. Overall, this compound's characteristics make it a candidate for research in drug development and other applications in biochemistry and pharmacology.
Formula:C16H17N3O3
InChI:InChI=1S/C16H17N3O3/c20-15(18-10-13-5-4-8-17-9-13)11-19(12-16(21)22)14-6-2-1-3-7-14/h1-9H,10-12H2,(H,18,20)(H,21,22)
InChI key:InChIKey=SRJLABDPSAIGLH-UHFFFAOYSA-N
SMILES:N(CC(NCC=1C=CC=NC1)=O)(CC(O)=O)C2=CC=CC=C2
Synonyms:- N-[2-Oxo-2-[(3-pyridinylmethyl)amino]ethyl]-N-phenylglycine
- Glycine, N-[2-oxo-2-[(3-pyridinylmethyl)amino]ethyl]-N-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.