CAS 1142204-90-7
:N-[2-[(Cyclohexylmethyl)amino]-2-oxoethyl]-N-phenylglycine
Description:
N-[2-[(Cyclohexylmethyl)amino]-2-oxoethyl]-N-phenylglycine, with the CAS number 1142204-90-7, is a chemical compound that belongs to the class of amino acids and derivatives. This substance features a phenyl group and a cyclohexylmethyl group, contributing to its unique structural characteristics. The presence of the amino and carboxylic functional groups indicates that it can participate in various chemical reactions, including peptide bond formation. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting neurological or metabolic pathways. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, its pharmacological properties may be influenced by the steric and electronic effects of the cyclohexylmethyl and phenyl substituents. As with many compounds in medicinal chemistry, understanding its interactions at the molecular level is crucial for predicting its behavior in biological systems and potential therapeutic uses.
Formula:C17H24N2O3
InChI:InChI=1S/C17H24N2O3/c20-16(18-11-14-7-3-1-4-8-14)12-19(13-17(21)22)15-9-5-2-6-10-15/h2,5-6,9-10,14H,1,3-4,7-8,11-13H2,(H,18,20)(H,21,22)
InChI key:InChIKey=HILITJXQFLNXNX-UHFFFAOYSA-N
SMILES:N(CC(NCC1CCCCC1)=O)(CC(O)=O)C2=CC=CC=C2
Synonyms:- Glycine, N-[2-[(cyclohexylmethyl)amino]-2-oxoethyl]-N-phenyl-
- N-[2-[(Cyclohexylmethyl)amino]-2-oxoethyl]-N-phenylglycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.