CymitQuimica logo

CAS 1142204-96-3

:

N-[2-Oxo-2-(1-piperidinylamino)ethyl]-N-phenylglycine

Description:
N-[2-Oxo-2-(1-piperidinylamino)ethyl]-N-phenylglycine, identified by its CAS number 1142204-96-3, is a chemical compound that belongs to the class of amino acids and derivatives. This substance features a phenyl group and a piperidine ring, contributing to its potential biological activity. The presence of the 2-oxo group indicates that it may participate in various chemical reactions, including those involving nucleophiles. Its structure suggests that it could interact with biological targets, making it of interest in medicinal chemistry and drug development. The compound may exhibit properties such as solubility in organic solvents, and its stability can be influenced by pH and temperature. Additionally, the piperidine moiety may impart certain pharmacological properties, potentially affecting its binding affinity to receptors or enzymes. Overall, N-[2-Oxo-2-(1-piperidinylamino)ethyl]-N-phenylglycine represents a complex structure with potential applications in pharmaceuticals, although specific biological activities and mechanisms would require further investigation.
Formula:C15H21N3O3
InChI:InChI=1S/C15H21N3O3/c19-14(16-18-9-5-2-6-10-18)11-17(12-15(20)21)13-7-3-1-4-8-13/h1,3-4,7-8H,2,5-6,9-12H2,(H,16,19)(H,20,21)
InChI key:InChIKey=PGTBEGOACMPMQF-UHFFFAOYSA-N
SMILES:N(CC(NN1CCCCC1)=O)(CC(O)=O)C2=CC=CC=C2
Synonyms:
  • N-[2-Oxo-2-(1-piperidinylamino)ethyl]-N-phenylglycine
  • Glycine, N-[2-oxo-2-(1-piperidinylamino)ethyl]-N-phenyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.