CymitQuimica logo

CAS 1142205-04-6

:

N-[2-Oxo-2-[(2-phenylethyl)amino]ethyl]-N-phenylglycine

Description:
N-[2-Oxo-2-[(2-phenylethyl)amino]ethyl]-N-phenylglycine, identified by its CAS number 1142205-04-6, is a synthetic compound that belongs to the class of amino acids and derivatives. This substance features a phenyl group and an oxo group, contributing to its unique chemical properties. It is characterized by its potential biological activity, which may include interactions with various receptors or enzymes, making it of interest in pharmaceutical research. The presence of both the phenyl and the 2-phenylethyl groups suggests that it may exhibit lipophilic characteristics, potentially influencing its solubility and permeability in biological systems. Additionally, the compound's structure indicates that it may participate in hydrogen bonding due to the amino and carboxylic functional groups, which could affect its reactivity and stability. Overall, N-[2-Oxo-2-[(2-phenylethyl)amino]ethyl]-N-phenylglycine represents a complex molecule with potential applications in medicinal chemistry and drug development.
Formula:C18H20N2O3
InChI:InChI=1S/C18H20N2O3/c21-17(19-12-11-15-7-3-1-4-8-15)13-20(14-18(22)23)16-9-5-2-6-10-16/h1-10H,11-14H2,(H,19,21)(H,22,23)
InChI key:InChIKey=UVHKUSMEZOVLAU-UHFFFAOYSA-N
SMILES:N(CC(NCCC1=CC=CC=C1)=O)(CC(O)=O)C2=CC=CC=C2
Synonyms:
  • Glycine, N-[2-oxo-2-[(2-phenylethyl)amino]ethyl]-N-phenyl-
  • N-[2-Oxo-2-[(2-phenylethyl)amino]ethyl]-N-phenylglycine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.