
CAS 1142205-12-6
:N-[2-Oxo-2-[[[4-(trifluoromethyl)phenyl]methyl]amino]ethyl]-N-phenylglycine
Description:
N-[2-Oxo-2-[[[4-(trifluoromethyl)phenyl]methyl]amino]ethyl]-N-phenylglycine, identified by its CAS number 1142205-12-6, is a synthetic organic compound characterized by its complex structure, which includes a phenyl group, a glycine moiety, and a trifluoromethyl-substituted phenyl group. This compound typically exhibits properties associated with amino acids and their derivatives, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of functional groups. The trifluoromethyl group contributes to its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The presence of the keto group suggests potential reactivity, which could be exploited in various chemical reactions. Overall, this compound's unique structural features may confer specific pharmacological properties, making it a candidate for further investigation in medicinal chemistry and drug development.
Formula:C18H17F3N2O3
InChI:InChI=1S/C18H17F3N2O3/c19-18(20,21)14-8-6-13(7-9-14)10-22-16(24)11-23(12-17(25)26)15-4-2-1-3-5-15/h1-9H,10-12H2,(H,22,24)(H,25,26)
InChI key:InChIKey=ONZGLYIOTKDIMY-UHFFFAOYSA-N
SMILES:N(CC(NCC1=CC=C(C(F)(F)F)C=C1)=O)(CC(O)=O)C2=CC=CC=C2
Synonyms:- N-[2-Oxo-2-[[[4-(trifluoromethyl)phenyl]methyl]amino]ethyl]-N-phenylglycine
- Glycine, N-[2-oxo-2-[[[4-(trifluoromethyl)phenyl]methyl]amino]ethyl]-N-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.