
CAS 1142205-15-9
:N-[2-[[2-(2,4-Dichlorophenyl)ethyl]amino]-2-oxoethyl]-N-phenylglycine
Description:
N-[2-[[2-(2,4-Dichlorophenyl)ethyl]amino]-2-oxoethyl]-N-phenylglycine, with CAS number 1142205-15-9, is a synthetic compound that belongs to the class of amino acids and derivatives. This substance features a complex structure characterized by the presence of a phenyl group, a dichlorophenyl moiety, and an amino acid backbone. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The dichlorophenyl group may impart unique electronic and steric properties, influencing the compound's biological activity and interaction with receptors or enzymes. Additionally, the presence of the oxoethyl group indicates potential reactivity, which could be exploited in further chemical modifications or in the synthesis of related compounds. As with many synthetic organic compounds, understanding its solubility, stability, and reactivity under various conditions is crucial for its application in research and industry. Safety and handling considerations are also important, given the presence of chlorine substituents, which may pose environmental and health risks.
Formula:C18H18Cl2N2O3
InChI:InChI=1S/C18H18Cl2N2O3/c19-14-7-6-13(16(20)10-14)8-9-21-17(23)11-22(12-18(24)25)15-4-2-1-3-5-15/h1-7,10H,8-9,11-12H2,(H,21,23)(H,24,25)
InChI key:InChIKey=MGUZBNSRKZLXFA-UHFFFAOYSA-N
SMILES:N(CC(NCCC1=C(Cl)C=C(Cl)C=C1)=O)(CC(O)=O)C2=CC=CC=C2
Synonyms:- N-[2-[[2-(2,4-Dichlorophenyl)ethyl]amino]-2-oxoethyl]-N-phenylglycine
- Glycine, N-[2-[[2-(2,4-dichlorophenyl)ethyl]amino]-2-oxoethyl]-N-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.