
CAS 1142205-18-2
:N-[2-[[(2,4-Dichlorophenyl)methyl]amino]-2-oxoethyl]-N-phenylglycine
Description:
N-[2-[[(2,4-Dichlorophenyl)methyl]amino]-2-oxoethyl]-N-phenylglycine, identified by its CAS number 1142205-18-2, is a synthetic compound that belongs to the class of amino acids and derivatives. This substance features a phenylglycine backbone, which is modified with a dichlorophenylmethyl group and an oxoethyl moiety. The presence of the dichlorophenyl group suggests potential applications in pharmaceuticals, particularly in the development of compounds with biological activity, such as anti-inflammatory or analgesic properties. The compound's structure indicates it may exhibit specific interactions with biological targets due to the presence of both amino and carboxylic functional groups, which can participate in hydrogen bonding and other intermolecular interactions. Additionally, the dichlorophenyl substituent may influence the lipophilicity and overall pharmacokinetic profile of the molecule. As with many synthetic organic compounds, its stability, solubility, and reactivity would depend on environmental conditions such as pH and temperature, making it a subject of interest for further research in medicinal chemistry.
Formula:C17H16Cl2N2O3
InChI:InChI=1S/C17H16Cl2N2O3/c18-13-7-6-12(15(19)8-13)9-20-16(22)10-21(11-17(23)24)14-4-2-1-3-5-14/h1-8H,9-11H2,(H,20,22)(H,23,24)
InChI key:InChIKey=MDPLMKWWDQHDDH-UHFFFAOYSA-N
SMILES:N(CC(NCC1=C(Cl)C=C(Cl)C=C1)=O)(CC(O)=O)C2=CC=CC=C2
Synonyms:- Glycine, N-[2-[[(2,4-dichlorophenyl)methyl]amino]-2-oxoethyl]-N-phenyl-
- N-[2-[[(2,4-Dichlorophenyl)methyl]amino]-2-oxoethyl]-N-phenylglycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.