CAS 1142205-20-6
:N-[2-[[(3,4-Dichlorophenyl)methyl]amino]-2-oxoethyl]-N-phenylglycine
Description:
N-[2-[[(3,4-Dichlorophenyl)methyl]amino]-2-oxoethyl]-N-phenylglycine, identified by its CAS number 1142205-20-6, is a chemical compound that exhibits characteristics typical of amino acids and their derivatives. This substance features a phenylglycine backbone, which is an amino acid structure, and is substituted with a dichlorophenyl group, enhancing its potential biological activity. The presence of the oxoethyl moiety suggests that it may participate in various chemical reactions, including those involving nucleophiles or electrophiles. The dichlorophenyl group may contribute to its lipophilicity, potentially influencing its solubility and permeability in biological systems. Additionally, the compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its structural complexity indicates potential interactions with biological targets, which could be explored for therapeutic applications. As with many compounds of this nature, understanding its stability, reactivity, and biological interactions would be essential for further development and application in research or pharmaceuticals.
Formula:C17H16Cl2N2O3
InChI:InChI=1S/C17H16Cl2N2O3/c18-14-7-6-12(8-15(14)19)9-20-16(22)10-21(11-17(23)24)13-4-2-1-3-5-13/h1-8H,9-11H2,(H,20,22)(H,23,24)
InChI key:InChIKey=YYBBRCIZRUNKEX-UHFFFAOYSA-N
SMILES:N(CC(NCC1=CC(Cl)=C(Cl)C=C1)=O)(CC(O)=O)C2=CC=CC=C2
Synonyms:- Glycine, N-[2-[[(3,4-dichlorophenyl)methyl]amino]-2-oxoethyl]-N-phenyl-
- N-[2-[[(3,4-Dichlorophenyl)methyl]amino]-2-oxoethyl]-N-phenylglycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.