CAS 1142205-21-7

N-[2-(Cycloheptylamino)-2-oxoethyl]-N-phenylglycine

Description:

N-[2-(Cycloheptylamino)-2-oxoethyl]-N-phenylglycine, with the CAS number 1142205-21-7, is a chemical compound characterized by its unique structure that includes a cycloheptylamino group and a phenylglycine moiety. This compound typically exhibits properties associated with amino acids and their derivatives, such as potential solubility in polar solvents due to the presence of amino and carboxylic functional groups. The cycloheptyl ring contributes to its steric bulk, which may influence its biological activity and interaction with receptors or enzymes. The presence of the phenyl group can enhance lipophilicity, potentially affecting its pharmacokinetic properties. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability and reactivity would depend on the specific conditions under which it is handled. Overall, N-[2-(Cycloheptylamino)-2-oxoethyl]-N-phenylglycine represents a complex structure with potential applications in drug development and biochemical research.

Formula: C₁₇H₂₄N₂O₃

InChI: InChI=1S/C17H24N2O3/c20-16(18-14-8-4-1-2-5-9-14)12-19(13-17(21)22)15-10-6-3-7-11-15/h3,6-7,10-11,14H,1-2,4-5,8-9,12-13H2,(H,18,20)(H,21,22)

InChI key: InChIKey=PAHVJWKAAROYGM-UHFFFAOYSA-N

SMILES: N(CC(NC1CCCCCC1)=O)(CC(O)=O)C2=CC=CC=C2

Synonyms:

• N-[2-(Cycloheptylamino)-2-oxoethyl]-N-phenylglycine
• Glycine, N-[2-(cycloheptylamino)-2-oxoethyl]-N-phenyl-