CAS 1142205-31-9

N-[2-(4-Ethyl-1-piperazinyl)-2-oxoethyl]-N-(4-methoxyphenyl)glycine

Description:

N-[2-(4-Ethyl-1-piperazinyl)-2-oxoethyl]-N-(4-methoxyphenyl)glycine is a chemical compound characterized by its complex structure, which includes a glycine backbone modified with a piperazine moiety and an ethyl group. This compound features a methoxyphenyl substituent, contributing to its potential biological activity. The presence of the piperazine ring suggests possible interactions with neurotransmitter receptors, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological conditions. The oxoethyl group enhances the compound's reactivity and solubility, which can influence its pharmacokinetic properties. Additionally, the ethyl and methoxy groups may affect lipophilicity and overall molecular stability. As with many compounds in this class, its specific characteristics, such as melting point, solubility, and biological activity, would depend on the precise arrangement of its functional groups and the stereochemistry of the molecule. Overall, this compound represents a class of molecules that may have therapeutic potential, warranting further investigation in drug development contexts.

Formula: C₁₇H₂₅N₃O₄

InChI: InChI=1S/C17H25N3O4/c1-3-18-8-10-19(11-9-18)16(21)12-20(13-17(22)23)14-4-6-15(24-2)7-5-14/h4-7H,3,8-13H2,1-2H3,(H,22,23)

InChI key: InChIKey=WAYAYCBLLWFLDN-UHFFFAOYSA-N

SMILES: N(CC(=O)N1CCN(CC)CC1)(CC(O)=O)C2=CC=C(OC)C=C2

Synonyms:

• Glycine, N-[2-(4-ethyl-1-piperazinyl)-2-oxoethyl]-N-(4-methoxyphenyl)-
• N-[2-(4-Ethyl-1-piperazinyl)-2-oxoethyl]-N-(4-methoxyphenyl)glycine
• N-(2-(4-ethylpiperazin-1-yl)-2-oxoethyl)-N-(4-methoxyphenyl)glycine
• [[2-(4-ethylpiperazin-1-yl)-2-oxoethyl](4-methoxyphenyl)amino]acetic acid