
CAS 1142205-34-2
:1-Ethyl 4-[2-[(carboxymethyl)(4-methoxyphenyl)amino]acetyl]-1-piperazinecarboxylate
Description:
1-Ethyl 4-[2-[(carboxymethyl)(4-methoxyphenyl)amino]acetyl]-1-piperazinecarboxylate is a complex organic compound characterized by its piperazine core, which is a six-membered heterocyclic amine. This substance features multiple functional groups, including an ethyl group, a carboxymethyl group, and an acetamido moiety, contributing to its potential solubility in polar solvents. The presence of the methoxyphenyl group suggests possible aromatic interactions, which may influence its biological activity and stability. The carboxylate functionality indicates that it can exist in both protonated and deprotonated forms, depending on the pH of the environment, which may affect its reactivity and interaction with biological targets. This compound may exhibit properties relevant to medicinal chemistry, particularly in drug design, due to its structural complexity and the presence of multiple functional groups that can participate in various chemical reactions. Overall, its unique structure may provide insights into its potential applications in pharmaceuticals or as a biochemical probe.
Formula:C18H25N3O6
InChI:InChI=1S/C18H25N3O6/c1-3-27-18(25)20-10-8-19(9-11-20)16(22)12-21(13-17(23)24)14-4-6-15(26-2)7-5-14/h4-7H,3,8-13H2,1-2H3,(H,23,24)
InChI key:InChIKey=FVMNLZZJTNOWGN-UHFFFAOYSA-N
SMILES:N(CC(=O)N1CCN(C(OCC)=O)CC1)(CC(O)=O)C2=CC=C(OC)C=C2
Synonyms:- 1-Ethyl 4-[2-[(carboxymethyl)(4-methoxyphenyl)amino]acetyl]-1-piperazinecarboxylate
- 1-Piperazinecarboxylic acid, 4-[2-[(carboxymethyl)(4-methoxyphenyl)amino]acetyl]-, 1-ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.