
CAS 1142205-37-5
:N-[2-[4-(2-Fluorophenyl)-1-piperazinyl]-2-oxoethyl]-N-(4-methoxyphenyl)glycine
Description:
N-[2-[4-(2-Fluorophenyl)-1-piperazinyl]-2-oxoethyl]-N-(4-methoxyphenyl)glycine, identified by its CAS number 1142205-37-5, is a synthetic compound that belongs to the class of amino acids and derivatives. This substance features a piperazine ring, which is known for its pharmacological properties, and incorporates a fluorophenyl group that may enhance its biological activity. The presence of a methoxyphenyl moiety suggests potential interactions with various biological targets, possibly influencing its solubility and lipophilicity. The compound's structure indicates it may exhibit properties relevant to medicinal chemistry, particularly in the development of therapeutics targeting neurological or psychiatric disorders. Its specific characteristics, such as melting point, solubility, and stability, would typically be determined through experimental methods. Additionally, the compound's potential applications would depend on its biological activity, which could be explored through in vitro and in vivo studies. Overall, this compound represents a complex molecular architecture that may hold promise in pharmaceutical research.
Formula:C21H24FN3O4
InChI:InChI=1S/C21H24FN3O4/c1-29-17-8-6-16(7-9-17)25(15-21(27)28)14-20(26)24-12-10-23(11-13-24)19-5-3-2-4-18(19)22/h2-9H,10-15H2,1H3,(H,27,28)
InChI key:InChIKey=DASZWXTYQPYNNX-UHFFFAOYSA-N
SMILES:FC1=C(N2CCN(C(CN(CC(O)=O)C3=CC=C(OC)C=C3)=O)CC2)C=CC=C1
Synonyms:- Glycine, N-[2-[4-(2-fluorophenyl)-1-piperazinyl]-2-oxoethyl]-N-(4-methoxyphenyl)-
- N-[2-[4-(2-Fluorophenyl)-1-piperazinyl]-2-oxoethyl]-N-(4-methoxyphenyl)glycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.