
CAS 1142205-38-6
:N-[2-[4-(4-Fluorophenyl)-1-piperazinyl]-2-oxoethyl]-N-(4-methoxyphenyl)glycine
Description:
N-[2-[4-(4-Fluorophenyl)-1-piperazinyl]-2-oxoethyl]-N-(4-methoxyphenyl)glycine, identified by its CAS number 1142205-38-6, is a chemical compound that belongs to the class of amino acids and derivatives. This substance features a piperazine ring, which is a common motif in pharmaceuticals, contributing to its potential biological activity. The presence of a fluorophenyl group suggests that it may exhibit specific interactions with biological targets, potentially enhancing its pharmacological properties. The methoxyphenyl substituent can influence the compound's lipophilicity and solubility, affecting its absorption and distribution in biological systems. Additionally, the oxoethyl group indicates the presence of a carbonyl functionality, which may play a role in the compound's reactivity and interactions. Overall, this compound's structural characteristics suggest it may have applications in medicinal chemistry, particularly in the development of therapeutics targeting neurological or psychiatric conditions, although specific biological activities would require further investigation through experimental studies.
Formula:C21H24FN3O4
InChI:InChI=1S/C21H24FN3O4/c1-29-19-8-6-18(7-9-19)25(15-21(27)28)14-20(26)24-12-10-23(11-13-24)17-4-2-16(22)3-5-17/h2-9H,10-15H2,1H3,(H,27,28)
InChI key:InChIKey=UVHLJJKVTZROBH-UHFFFAOYSA-N
SMILES:N(CC(=O)N1CCN(CC1)C2=CC=C(F)C=C2)(CC(O)=O)C3=CC=C(OC)C=C3
Synonyms:- Glycine, N-[2-[4-(4-fluorophenyl)-1-piperazinyl]-2-oxoethyl]-N-(4-methoxyphenyl)-
- N-[2-[4-(4-Fluorophenyl)-1-piperazinyl]-2-oxoethyl]-N-(4-methoxyphenyl)glycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.