CAS 1142205-65-9

N-(4-Methoxyphenyl)-N-[2-oxo-2-(4-thiomorpholinyl)ethyl]glycine

Description:

N-(4-Methoxyphenyl)-N-[2-oxo-2-(4-thiomorpholinyl)ethyl]glycine, with CAS number 1142205-65-9, is a synthetic compound that belongs to the class of amino acids and derivatives. This substance features a glycine backbone, which is modified by the presence of a 4-methoxyphenyl group and a thiomorpholine moiety. The compound exhibits characteristics typical of amino acids, such as the ability to participate in hydrogen bonding due to its amine and carboxylic acid functional groups. The presence of the methoxy group enhances its lipophilicity, potentially influencing its biological activity and solubility. Additionally, the thiomorpholine ring contributes to its structural complexity and may affect its pharmacokinetic properties. This compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, where modifications to amino acid structures can lead to novel therapeutic agents. As with many synthetic compounds, its stability, reactivity, and interactions with biological systems would require thorough investigation through experimental studies.

Formula: C₁₅H₂₀N₂O₄S

InChI: InChI=1S/C15H20N2O4S/c1-21-13-4-2-12(3-5-13)17(11-15(19)20)10-14(18)16-6-8-22-9-7-16/h2-5H,6-11H2,1H3,(H,19,20)

InChI key: InChIKey=QEXTUJGEHKMQKN-UHFFFAOYSA-N

SMILES: N(CC(=O)N1CCSCC1)(CC(O)=O)C2=CC=C(OC)C=C2

Synonyms:

• Glycine, N-(4-methoxyphenyl)-N-[2-oxo-2-(4-thiomorpholinyl)ethyl]-
• N-(4-Methoxyphenyl)-N-[2-oxo-2-(4-thiomorpholinyl)ethyl]glycine