
CAS 1142205-71-7
:4-Ethyl 1-[2-[(carboxymethyl)(4-methoxyphenyl)amino]acetyl]-4-piperidinecarboxylate
Description:
4-Ethyl 1-[2-[(carboxymethyl)(4-methoxyphenyl)amino]acetyl]-4-piperidinecarboxylate is a complex organic compound characterized by its piperidine core, which is a six-membered nitrogen-containing ring. This substance features an ethyl group and a carboxymethyl group, contributing to its solubility and reactivity. The presence of a 4-methoxyphenyl group indicates that it has aromatic characteristics, which can influence its electronic properties and interactions with biological systems. The compound also contains an acetyl group, suggesting potential reactivity in acylation reactions. Its carboxylate functionality implies that it can exist in both protonated and deprotonated forms, affecting its acid-base behavior. This compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry. Overall, its unique combination of functional groups and structural elements suggests potential applications in pharmaceuticals or as a biochemical probe, although specific biological activities would require further investigation.
Formula:C19H26N2O6
InChI:InChI=1S/C19H26N2O6/c1-3-27-19(25)14-8-10-20(11-9-14)17(22)12-21(13-18(23)24)15-4-6-16(26-2)7-5-15/h4-7,14H,3,8-13H2,1-2H3,(H,23,24)
InChI key:InChIKey=QESVNQYGNVMRSG-UHFFFAOYSA-N
SMILES:N(CC(=O)N1CCC(C(OCC)=O)CC1)(CC(O)=O)C2=CC=C(OC)C=C2
Synonyms:- 4-Ethyl 1-[2-[(carboxymethyl)(4-methoxyphenyl)amino]acetyl]-4-piperidinecarboxylate
- 4-Piperidinecarboxylic acid, 1-[2-[(carboxymethyl)(4-methoxyphenyl)amino]acetyl]-, 4-ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.