CymitQuimica logo

CAS 1142205-76-2

:

N-[2-(4-Hydroxy-1-piperidinyl)-2-oxoethyl]-N-(4-methoxyphenyl)glycine

Description:
N-[2-(4-Hydroxy-1-piperidinyl)-2-oxoethyl]-N-(4-methoxyphenyl)glycine, identified by its CAS number 1142205-76-2, is a chemical compound that features a complex structure incorporating both amino acid and piperidine functionalities. This substance is characterized by the presence of a glycine moiety, which contributes to its potential biological activity, particularly in the context of neuropharmacology. The 4-hydroxy-1-piperidinyl group suggests possible interactions with neurotransmitter systems, while the 4-methoxyphenyl group may enhance lipophilicity, influencing its pharmacokinetic properties. The compound's structure indicates it may exhibit properties such as solubility in polar solvents and potential for hydrogen bonding due to the hydroxyl group. Its unique combination of functional groups suggests that it could be investigated for therapeutic applications, possibly in the treatment of neurological disorders. However, specific biological activity, toxicity, and pharmacological profiles would require further empirical studies to elucidate its potential uses and safety.
Formula:C16H22N2O5
InChI:InChI=1S/C16H22N2O5/c1-23-14-4-2-12(3-5-14)18(11-16(21)22)10-15(20)17-8-6-13(19)7-9-17/h2-5,13,19H,6-11H2,1H3,(H,21,22)
InChI key:InChIKey=WNJZGTKLUVXTSX-UHFFFAOYSA-N
SMILES:N(CC(=O)N1CCC(O)CC1)(CC(O)=O)C2=CC=C(OC)C=C2
Synonyms:
  • Glycine, N-[2-(4-hydroxy-1-piperidinyl)-2-oxoethyl]-N-(4-methoxyphenyl)-
  • N-[2-(4-Hydroxy-1-piperidinyl)-2-oxoethyl]-N-(4-methoxyphenyl)glycine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.