
CAS 1142205-89-7
:N-[2-[4-(2-Furanylcarbonyl)-1-piperazinyl]-2-oxoethyl]-N-(4-methoxyphenyl)glycine
Description:
N-[2-[4-(2-Furanylcarbonyl)-1-piperazinyl]-2-oxoethyl]-N-(4-methoxyphenyl)glycine is a synthetic compound characterized by its complex structure, which includes a glycine backbone modified with a piperazine moiety and a furanylcarbonyl group. This compound features a methoxyphenyl substituent, contributing to its potential biological activity. The presence of the piperazine ring suggests possible interactions with neurotransmitter receptors, making it of interest in pharmacological research. The furanyl group may enhance lipophilicity, potentially influencing the compound's solubility and permeability. The compound's design indicates potential applications in medicinal chemistry, particularly in the development of therapeutic agents targeting central nervous system disorders. Its specific interactions and efficacy would require further investigation through biological assays and pharmacokinetic studies. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function, highlighting the importance of chemical modifications in drug design.
Formula:C20H23N3O6
InChI:InChI=1S/C20H23N3O6/c1-28-16-6-4-15(5-7-16)23(14-19(25)26)13-18(24)21-8-10-22(11-9-21)20(27)17-3-2-12-29-17/h2-7,12H,8-11,13-14H2,1H3,(H,25,26)
InChI key:InChIKey=FIUAKHXUWJOBGM-UHFFFAOYSA-N
SMILES:N(CC(=O)N1CCN(C(=O)C2=CC=CO2)CC1)(CC(O)=O)C3=CC=C(OC)C=C3
Synonyms:- Glycine, N-[2-[4-(2-furanylcarbonyl)-1-piperazinyl]-2-oxoethyl]-N-(4-methoxyphenyl)-
- N-[2-[4-(2-Furanylcarbonyl)-1-piperazinyl]-2-oxoethyl]-N-(4-methoxyphenyl)glycine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.