CAS 1142205-97-7

N-[2-(4-Methyl-1-piperazinyl)-2-oxoethyl]-N-phenylglycine

Description:

N-[2-(4-Methyl-1-piperazinyl)-2-oxoethyl]-N-phenylglycine, identified by its CAS number 1142205-97-7, is a chemical compound that features a piperazine moiety, which is a six-membered ring containing two nitrogen atoms. This compound is characterized by its dual functional groups: a phenyl group and a glycine derivative, which contribute to its potential biological activity. The presence of the 4-methyl group on the piperazine enhances its lipophilicity, potentially influencing its pharmacokinetic properties. The oxoethyl side chain suggests that it may participate in various chemical reactions, including those involving amide or ester linkages. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or psychiatric disorders, given the structural similarities to known psychoactive agents. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and temperature, making it a subject of interest for further research in drug development and synthesis.

Formula: C₁₅H₂₁N₃O₃

InChI: InChI=1S/C15H21N3O3/c1-16-7-9-17(10-8-16)14(19)11-18(12-15(20)21)13-5-3-2-4-6-13/h2-6H,7-12H2,1H3,(H,20,21)

InChI key: InChIKey=IKALENXVHZWXIK-UHFFFAOYSA-N

SMILES: N(CC(=O)N1CCN(C)CC1)(CC(O)=O)C2=CC=CC=C2

Synonyms:

• Glycine, N-[2-(4-methyl-1-piperazinyl)-2-oxoethyl]-N-phenyl-
• N-[2-(4-Methyl-1-piperazinyl)-2-oxoethyl]-N-phenylglycine