CAS 1142205-98-8
:N-[2-(4-Ethyl-1-piperazinyl)-2-oxoethyl]-N-phenylglycine
Description:
N-[2-(4-Ethyl-1-piperazinyl)-2-oxoethyl]-N-phenylglycine, with the CAS number 1142205-98-8, is a chemical compound that belongs to the class of amino acids and derivatives. This substance features a phenyl group and a piperazine moiety, which contribute to its potential biological activity. The presence of the ethyl group on the piperazine ring may influence its lipophilicity and interaction with biological targets. The compound is characterized by its amide functional group, which is indicative of its potential to form hydrogen bonds, enhancing solubility in polar solvents. Its structure suggests that it may exhibit pharmacological properties, possibly acting as a ligand for various receptors or enzymes. The specific stereochemistry and conformation of the molecule can significantly affect its biological activity and interactions. As with many compounds in medicinal chemistry, further studies would be necessary to elucidate its mechanism of action, efficacy, and safety profile in potential therapeutic applications.
Formula:C16H23N3O3
InChI:InChI=1S/C16H23N3O3/c1-2-17-8-10-18(11-9-17)15(20)12-19(13-16(21)22)14-6-4-3-5-7-14/h3-7H,2,8-13H2,1H3,(H,21,22)
InChI key:InChIKey=WNHRICUVGBEETI-UHFFFAOYSA-N
SMILES:N(CC(=O)N1CCN(CC)CC1)(CC(O)=O)C2=CC=CC=C2
Synonyms:- N-[2-(4-Ethyl-1-piperazinyl)-2-oxoethyl]-N-phenylglycine
- Glycine, N-[2-(4-ethyl-1-piperazinyl)-2-oxoethyl]-N-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.