CymitQuimica logo

CAS 1142207-48-4

:

6-Amino-4-(2,3-dichlorophenyl)-3,4-dihydro-1,3,5-triazine-2(1H)-thione

Description:
6-Amino-4-(2,3-dichlorophenyl)-3,4-dihydro-1,3,5-triazine-2(1H)-thione is a heterocyclic compound characterized by its triazine core, which features a thione functional group and an amino substituent. The presence of the 2,3-dichlorophenyl group contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. This compound is likely to exhibit moderate to high polarity due to the presence of both amino and thione groups, which can engage in hydrogen bonding. Its structure suggests potential applications in pharmaceuticals or agrochemicals, particularly as a building block for more complex molecules. The triazine ring system is known for its stability and ability to participate in various chemical reactions, including nucleophilic substitutions. Additionally, the dichlorophenyl moiety may enhance the compound's lipophilicity, affecting its solubility and bioavailability. Overall, this compound's unique structural features make it of interest in various fields of chemical research and development.
Formula:C9H8Cl2N4S
InChI:InChI=1S/C9H8Cl2N4S/c10-5-3-1-2-4(6(5)11)7-13-8(12)15-9(16)14-7/h1-3,7H,(H4,12,13,14,15,16)
InChI key:InChIKey=ZYZCKSROPRQLNG-UHFFFAOYSA-N
SMILES:ClC1=C(C2NC(N)=NC(=S)N2)C=CC=C1Cl
Synonyms:
  • 1,3,5-Triazine-2(1H)-thione, 6-amino-4-(2,3-dichlorophenyl)-3,4-dihydro-
  • 6-Amino-4-(2,3-dichlorophenyl)-3,4-dihydro-1,3,5-triazine-2(1H)-thione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.