
CAS 1142207-75-7
:6-Amino-3,4-dihydro-4-(2-methoxyphenyl)-1,3,5-triazine-2(1H)-thione
Description:
6-Amino-3,4-dihydro-4-(2-methoxyphenyl)-1,3,5-triazine-2(1H)-thione is a chemical compound characterized by its triazine core, which features a thione functional group and an amino substituent. The presence of the 2-methoxyphenyl group contributes to its aromatic properties, enhancing its potential for various chemical interactions. This compound typically exhibits moderate solubility in polar solvents due to the presence of the amino and thione groups, which can engage in hydrogen bonding. Its structure suggests potential biological activity, making it of interest in medicinal chemistry and drug development. The thione group may also impart unique reactivity, allowing for further derivatization. Additionally, the compound's stability can be influenced by environmental factors such as pH and temperature. Overall, 6-Amino-3,4-dihydro-4-(2-methoxyphenyl)-1,3,5-triazine-2(1H)-thione represents a versatile scaffold for further research and application in various fields, including pharmaceuticals and agrochemicals.
Formula:C10H12N4OS
InChI:InChI=1S/C10H12N4OS/c1-15-7-5-3-2-4-6(7)8-12-9(11)14-10(16)13-8/h2-5,8H,1H3,(H4,11,12,13,14,16)
InChI key:InChIKey=YYCSIONLNSGRRG-UHFFFAOYSA-N
SMILES:O(C)C1=C(C2NC(N)=NC(=S)N2)C=CC=C1
Synonyms:- 1,3,5-Triazine-2(1H)-thione, 6-amino-3,4-dihydro-4-(2-methoxyphenyl)-
- 6-Amino-3,4-dihydro-4-(2-methoxyphenyl)-1,3,5-triazine-2(1H)-thione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.