CAS 1142207-94-0

6-Amino-3,4-dihydro-4-[4-(1-methylethyl)phenyl]-1,3,5-triazine-2(1H)-thione

Description:

6-Amino-3,4-dihydro-4-[4-(1-methylethyl)phenyl]-1,3,5-triazine-2(1H)-thione is a chemical compound characterized by its triazine core, which is a six-membered ring containing three nitrogen atoms and three carbon atoms. This compound features an amino group, which contributes to its potential as a building block in organic synthesis and pharmaceuticals. The presence of a thione functional group (a sulfur atom double-bonded to a carbon atom) enhances its reactivity and may influence its biological activity. The isopropyl-substituted phenyl group indicates that the compound may exhibit hydrophobic characteristics, potentially affecting its solubility and interaction with biological membranes. The structural complexity suggests that it may have applications in medicinal chemistry, particularly in the development of agrochemicals or pharmaceuticals. Additionally, the presence of multiple functional groups can lead to diverse reactivity patterns, making it a candidate for further chemical modifications. Overall, this compound's unique structure and functional groups position it as an interesting subject for research in various chemical applications.

Formula: C₁₂H₁₆N₄S

InChI: InChI=1S/C12H16N4S/c1-7(2)8-3-5-9(6-4-8)10-14-11(13)16-12(17)15-10/h3-7,10H,1-2H3,(H4,13,14,15,16,17)

InChI key: InChIKey=FSMMSEOGNZUBRM-UHFFFAOYSA-N

SMILES: NC=1NC(C2=CC=C(C(C)C)C=C2)NC(=S)N1

Synonyms:

• 6-Amino-3,4-dihydro-4-[4-(1-methylethyl)phenyl]-1,3,5-triazine-2(1H)-thione
• 1,3,5-Triazine-2(1H)-thione, 6-amino-3,4-dihydro-4-[4-(1-methylethyl)phenyl]-