CymitQuimica logo

CAS 1142207-98-4

:

6-Amino-3,4-dihydro-4-(1-naphthalenyl)-1,3,5-triazine-2(1H)-thione

Description:
6-Amino-3,4-dihydro-4-(1-naphthalenyl)-1,3,5-triazine-2(1H)-thione is a heterocyclic compound characterized by its triazine core, which features a thione functional group and an amino substituent. The presence of the naphthalenyl group contributes to its aromatic properties and may influence its electronic characteristics and reactivity. This compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic naphthalene moiety, while the amino and thione groups can engage in hydrogen bonding, potentially enhancing solubility in polar solvents. The triazine ring system is known for its stability and can participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. Additionally, compounds of this type may possess biological activity, making them of interest in medicinal chemistry and drug development. Overall, the unique structural features of 6-Amino-3,4-dihydro-4-(1-naphthalenyl)-1,3,5-triazine-2(1H)-thione suggest potential applications in pharmaceuticals and materials science.
Formula:C13H12N4S
InChI:InChI=1S/C13H12N4S/c14-12-15-11(16-13(18)17-12)10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11H,(H4,14,15,16,17,18)
InChI key:InChIKey=VTJNSYFFXCPHJF-UHFFFAOYSA-N
SMILES:NC=1NC(C=2C3=C(C=CC2)C=CC=C3)NC(=S)N1
Synonyms:
  • 6-Amino-3,4-dihydro-4-(1-naphthalenyl)-1,3,5-triazine-2(1H)-thione
  • 1,3,5-Triazine-2(1H)-thione, 6-amino-3,4-dihydro-4-(1-naphthalenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.