
CAS 1142208-15-8
:6-Amino-3,4-dihydro-4-(2-methylphenyl)-1,3,5-triazine-2(1H)-thione
Description:
6-Amino-3,4-dihydro-4-(2-methylphenyl)-1,3,5-triazine-2(1H)-thione is a chemical compound characterized by its triazine core, which features a thione functional group and an amino substituent. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the amino group, which can participate in hydrogen bonding and other interactions. The 2-methylphenyl group contributes to its hydrophobic characteristics, potentially influencing its solubility and reactivity. The presence of the thione group suggests that it may exhibit properties similar to thiols, such as nucleophilicity. Additionally, the compound may have applications in pharmaceuticals or agrochemicals, given the structural motifs common in biologically active molecules. Its stability, reactivity, and specific interactions would depend on the surrounding conditions, such as pH and solvent. Overall, this compound represents a unique structure within the triazine family, with potential implications in various chemical and biological contexts.
Formula:C10H12N4S
InChI:InChI=1S/C10H12N4S/c1-6-4-2-3-5-7(6)8-12-9(11)14-10(15)13-8/h2-5,8H,1H3,(H4,11,12,13,14,15)
InChI key:InChIKey=CIJFJBOOTBYJPA-UHFFFAOYSA-N
SMILES:CC1=C(C=CC=C1)C2NC(N)=NC(=S)N2
Synonyms:- 1,3,5-Triazine-2(1H)-thione, 6-amino-3,4-dihydro-4-(2-methylphenyl)-
- 6-Amino-3,4-dihydro-4-(2-methylphenyl)-1,3,5-triazine-2(1H)-thione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.