CAS 1142208-31-8

6-Amino-4-(3-bromophenyl)-3,4-dihydro-1,3,5-triazine-2(1H)-thione

Description:

6-Amino-4-(3-bromophenyl)-3,4-dihydro-1,3,5-triazine-2(1H)-thione is a heterocyclic compound characterized by the presence of a triazine ring, which is a six-membered ring containing three nitrogen atoms and three carbon atoms. This compound features an amino group and a thione functional group, contributing to its reactivity and potential biological activity. The presence of the 3-bromophenyl substituent enhances its lipophilicity and may influence its interaction with biological targets. The dihydro form indicates that the compound has two hydrogen atoms added to the triazine ring, which can affect its stability and reactivity. This compound may exhibit properties such as antimicrobial, antifungal, or anticancer activities, making it of interest in medicinal chemistry. Its unique structure allows for various synthetic modifications, potentially leading to derivatives with enhanced efficacy or selectivity. As with many heterocycles, the electronic properties and steric factors of the substituents play a crucial role in determining the compound's overall behavior in chemical reactions and biological systems.

Formula: C₉H₉BrN₄S

InChI: InChI=1S/C9H9BrN4S/c10-6-3-1-2-5(4-6)7-12-8(11)14-9(15)13-7/h1-4,7H,(H4,11,12,13,14,15)

InChI key: InChIKey=YJKXNFRJJJPTSL-UHFFFAOYSA-N

SMILES: NC=1NC(NC(=S)N1)C2=CC(Br)=CC=C2

Synonyms:

• 1,3,5-Triazine-2(1H)-thione, 6-amino-4-(3-bromophenyl)-3,4-dihydro-
• 6-Amino-4-(3-bromophenyl)-3,4-dihydro-1,3,5-triazine-2(1H)-thione