CymitQuimica logo

CAS 1142208-58-9

:

6-Amino-4-cyclopropyl-3,4-dihydro-1,3,5-triazine-2(1H)-thione

Description:
6-Amino-4-cyclopropyl-3,4-dihydro-1,3,5-triazine-2(1H)-thione is a heterocyclic compound characterized by its triazine core, which features a cyclopropyl group and an amino substituent. The presence of the thione functional group indicates that it contains a sulfur atom double-bonded to a carbon atom, contributing to its reactivity and potential biological activity. This compound is likely to exhibit properties typical of triazines, such as stability under various conditions, and may participate in nucleophilic substitution reactions due to the presence of the amino group. Its structure suggests potential applications in pharmaceuticals or agrochemicals, as triazine derivatives are often explored for their biological activities. The compound's solubility, melting point, and other physical properties would depend on its specific interactions with solvents and other substances. Overall, 6-Amino-4-cyclopropyl-3,4-dihydro-1,3,5-triazine-2(1H)-thione represents a unique structure within the triazine family, with potential implications in various fields of chemistry and biology.
Formula:C6H10N4S
InChI:InChI=1S/C6H10N4S/c7-5-8-4(3-1-2-3)9-6(11)10-5/h3-4H,1-2H2,(H4,7,8,9,10,11)
InChI key:InChIKey=AZQIONPWLYOBMT-UHFFFAOYSA-N
SMILES:NC=1NC(C2CC2)NC(=S)N1
Synonyms:
  • 6-Amino-4-cyclopropyl-3,4-dihydro-1,3,5-triazine-2(1H)-thione
  • 1,3,5-Triazine-2(1H)-thione, 6-amino-4-cyclopropyl-3,4-dihydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.