
CAS 1142208-59-0
:6-Amino-3,4-dihydro-4-(2-pyridinyl)-1,3,5-triazine-2(1H)-thione
Description:
6-Amino-3,4-dihydro-4-(2-pyridinyl)-1,3,5-triazine-2(1H)-thione is a heterocyclic compound characterized by its triazine core, which features a thione functional group and an amino group. The presence of a pyridine ring contributes to its aromatic properties and potential for various chemical interactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. Its structure suggests potential applications in pharmaceuticals, particularly in the development of agrochemicals or as a building block in organic synthesis. The thione group may impart unique reactivity, making it a candidate for further chemical modifications. Additionally, the compound's biological activity could be explored, given the known pharmacological properties of similar triazine derivatives. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate risks associated with its use.
Formula:C8H9N5S
InChI:InChI=1S/C8H9N5S/c9-7-11-6(12-8(14)13-7)5-3-1-2-4-10-5/h1-4,6H,(H4,9,11,12,13,14)
InChI key:InChIKey=NPEOIRKPPIFABT-UHFFFAOYSA-N
SMILES:NC=1NC(NC(=S)N1)C2=CC=CC=N2
Synonyms:- 1,3,5-Triazine-2(1H)-thione, 6-amino-3,4-dihydro-4-(2-pyridinyl)-
- 6-Amino-3,4-dihydro-4-(2-pyridinyl)-1,3,5-triazine-2(1H)-thione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.