CAS 1142208-66-9

6-Amino-3,4-dihydro-4-(1-methyl-1H-pyrrol-2-yl)-1,3,5-triazine-2(1H)-thione

Description:

6-Amino-3,4-dihydro-4-(1-methyl-1H-pyrrol-2-yl)-1,3,5-triazine-2(1H)-thione is a heterocyclic compound characterized by its triazine core, which features a thione functional group and an amino group. The presence of the 1-methyl-1H-pyrrol-2-yl substituent contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. This compound may exhibit various characteristics such as solubility in polar solvents, depending on the specific functional groups and their interactions. Its structure suggests potential applications in pharmaceuticals or agrochemicals, particularly due to the presence of the triazine moiety, which is known for its role in various biological activities. The thione group may also impart specific reactivity, making it a candidate for further chemical transformations. As with many heterocycles, the compound's stability, reactivity, and potential toxicity would need to be evaluated in the context of its intended use. Overall, this compound represents a complex structure with potential significance in medicinal chemistry and related fields.

Formula: C₈H₁₁N₅S

InChI: InChI=1S/C8H11N5S/c1-13-4-2-3-5(13)6-10-7(9)12-8(14)11-6/h2-4,6H,1H3,(H4,9,10,11,12,14)

InChI key: InChIKey=XNSABDIRDZEGDL-UHFFFAOYSA-N

SMILES: CN1C(=CC=C1)C2NC(N)=NC(=S)N2

Synonyms:

• 6-Amino-3,4-dihydro-4-(1-methyl-1H-pyrrol-2-yl)-1,3,5-triazine-2(1H)-thione
• 1,3,5-Triazine-2(1H)-thione, 6-amino-3,4-dihydro-4-(1-methyl-1H-pyrrol-2-yl)-