CAS 1142209-50-4

5-[[(5-Ethyl-1,3,4-thiadiazol-2-yl)amino]carbonyl]-1,3,4-thiadiazole-2-propanoic acid

Description:

5-[[(5-Ethyl-1,3,4-thiadiazol-2-yl)amino]carbonyl]-1,3,4-thiadiazole-2-propanoic acid is a chemical compound characterized by its complex structure, which includes multiple thiadiazole rings and an ethyl substituent. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the thiadiazole moiety suggests potential biological activity, as thiadiazoles are often associated with various pharmacological effects. The compound's molecular structure indicates it may participate in hydrogen bonding due to the carboxylic acid and amino groups, which could influence its solubility and reactivity. Additionally, the ethyl group may affect the lipophilicity of the molecule, potentially impacting its bioavailability and interaction with biological systems. Overall, this compound's unique features make it of interest in medicinal chemistry and related fields, where its properties could be explored for therapeutic applications.

Formula: C₁₀H₁₁N₅O₃S₂

InChI: InChI=1S/C10H11N5O3S2/c1-2-5-12-15-10(20-5)11-8(18)9-14-13-6(19-9)3-4-7(16)17/h2-4H2,1H3,(H,16,17)(H,11,15,18)

InChI key: InChIKey=ISIAWXAYUSUEIU-UHFFFAOYSA-N

SMILES: C(NC=1SC(CC)=NN1)(=O)C=2SC(CCC(O)=O)=NN2

Synonyms:

• 5-[[(5-Ethyl-1,3,4-thiadiazol-2-yl)amino]carbonyl]-1,3,4-thiadiazole-2-propanoic acid
• 1,3,4-Thiadiazole-2-propanoic acid, 5-[[(5-ethyl-1,3,4-thiadiazol-2-yl)amino]carbonyl]-