CAS 1142209-51-5
:5-[[(3-Chlorophenyl)amino]carbonyl]-1,3,4-thiadiazole-2-butanoic acid
Description:
5-[[(3-Chlorophenyl)amino]carbonyl]-1,3,4-thiadiazole-2-butanoic acid is a chemical compound characterized by its unique structural features, which include a thiadiazole ring and a butanoic acid moiety. The presence of a 3-chlorophenyl group contributes to its potential biological activity, as halogenated aromatic compounds often exhibit significant pharmacological properties. The thiadiazole ring is known for its role in various medicinal chemistry applications, including antimicrobial and anti-inflammatory activities. This compound may exhibit solubility in organic solvents, and its acidic functional group suggests it can participate in acid-base reactions. The specific arrangement of functional groups influences its reactivity, stability, and interaction with biological targets. As with many compounds containing nitrogen and sulfur, it may also exhibit interesting electronic properties. Overall, the characteristics of this compound make it a subject of interest in pharmaceutical research and development, particularly in the search for new therapeutic agents.
Formula:C13H12ClN3O3S
InChI:InChI=1S/C13H12ClN3O3S/c14-8-3-1-4-9(7-8)15-12(20)13-17-16-10(21-13)5-2-6-11(18)19/h1,3-4,7H,2,5-6H2,(H,15,20)(H,18,19)
InChI key:InChIKey=SYRJWSLECOXZJB-UHFFFAOYSA-N
SMILES:C(NC1=CC(Cl)=CC=C1)(=O)C=2SC(CCCC(O)=O)=NN2
Synonyms:- 1,3,4-Thiadiazole-2-butanoic acid, 5-[[(3-chlorophenyl)amino]carbonyl]-
- 5-[[(3-Chlorophenyl)amino]carbonyl]-1,3,4-thiadiazole-2-butanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.