CAS 1142209-57-1

1-[(4-Chlorophenyl)sulfonyl]-4-piperidineacetic acid

Description:

1-[(4-Chlorophenyl)sulfonyl]-4-piperidineacetic acid is a chemical compound characterized by its unique structure, which includes a piperidine ring and a sulfonyl group attached to a chlorophenyl moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the sulfonyl and carboxylic acid functional groups. Its molecular structure suggests it may engage in hydrogen bonding, influencing its reactivity and interactions with biological targets. The presence of the chlorophenyl group may impart specific electronic properties, potentially affecting its pharmacological activity. This compound is of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. Additionally, its CAS number, 1142209-57-1, serves as a unique identifier for regulatory and safety information. As with many chemical substances, handling should be conducted with care, adhering to safety protocols to mitigate any risks associated with its use.

Formula: C₁₃H₁₆ClNO₄S

InChI: InChI=1S/C13H16ClNO4S/c14-11-1-3-12(4-2-11)20(18,19)15-7-5-10(6-8-15)9-13(16)17/h1-4,10H,5-9H2,(H,16,17)

InChI key: InChIKey=UZDQUOZVACHLMK-UHFFFAOYSA-N

SMILES: S(=O)(=O)(N1CCC(CC(O)=O)CC1)C2=CC=C(Cl)C=C2

Synonyms:

• 1-[(4-Chlorophenyl)sulfonyl]-4-piperidineacetic acid
• 4-Piperidineacetic acid, 1-[(4-chlorophenyl)sulfonyl]-