CymitQuimica logo

CAS 1142209-59-3

:

5-[[(5-Phenyl-1,3,4-thiadiazol-2-yl)amino]carbonyl]-1,3,4-thiadiazole-2-butanoic acid

Description:
5-[[(5-Phenyl-1,3,4-thiadiazol-2-yl)amino]carbonyl]-1,3,4-thiadiazole-2-butanoic acid is a chemical compound characterized by its complex structure, which includes multiple thiadiazole rings and an amino acid moiety. This compound features a phenyl group attached to a thiadiazole, contributing to its potential biological activity. The presence of the carboxylic acid functional group suggests that it may exhibit acidic properties, influencing its solubility and reactivity in various environments. The thiadiazole rings are known for their diverse pharmacological properties, including antimicrobial and anti-inflammatory activities. As a result, compounds of this nature are often investigated for their potential therapeutic applications. The specific arrangement of functional groups in this molecule may also affect its interaction with biological targets, making it a subject of interest in medicinal chemistry. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function, highlighting the importance of thiadiazole derivatives in drug discovery and development.
Formula:C15H13N5O3S2
InChI:InChI=1S/C15H13N5O3S2/c21-11(22)8-4-7-10-17-19-14(24-10)12(23)16-15-20-18-13(25-15)9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2,(H,21,22)(H,16,20,23)
InChI key:InChIKey=NMMXKVIZIOHLDF-UHFFFAOYSA-N
SMILES:N(C(=O)C=1SC(CCCC(O)=O)=NN1)C=2SC(=NN2)C3=CC=CC=C3
Synonyms:
  • 5-[[(5-Phenyl-1,3,4-thiadiazol-2-yl)amino]carbonyl]-1,3,4-thiadiazole-2-butanoic acid
  • 1,3,4-Thiadiazole-2-butanoic acid, 5-[[(5-phenyl-1,3,4-thiadiazol-2-yl)amino]carbonyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.