CAS 1142209-70-8: 2-[[5-[[(3-Chlorophenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]methoxy]acetic acid
Description:2-[[5-[[(3-Chlorophenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]methoxy]acetic acid is a chemical compound characterized by its complex structure, which includes a thiadiazole ring, a methoxy group, and an acetic acid moiety. The presence of the 3-chlorophenyl group contributes to its potential biological activity, as halogenated aromatic compounds often exhibit significant pharmacological properties. This compound is likely to be a polar molecule due to the presence of the carboxylic acid functional group, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The thiadiazole ring may impart unique reactivity and stability, making it of interest in medicinal chemistry. Additionally, the compound's structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties could be further explored through various analytical methods, including spectroscopy and chromatography, to determine its purity and structural integrity.
Formula:C12H10ClN3O4S
InChI:InChI=1S/C12H10ClN3O4S/c13-7-2-1-3-8(4-7)14-11(19)12-16-15-9(21-12)5-20-6-10(17)18/h1-4H,5-6H2,(H,14,19)(H,17,18)
InChI key:InChIKey=IXLLIDAXWRTFLG-UHFFFAOYSA-N
SMILES:O=C(O)COCC1=NN=C(S1)C(=O)NC=2C=CC=C(Cl)C2
- Synonyms:
- 2-[[5-[[(3-Chlorophenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]methoxy]acetic acid
- Acetic acid, 2-[[5-[[(3-chlorophenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]methoxy]-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | [(5-{[(3-chlorophenyl)amino]carbonyl}-1,3,4-thiadiazol-2-yl)methoxy]acetic acid REF: 10-F367780CAS: 1142209-70-8 | - - - | - - - | Discontinued product |
![]() | [(5-{[(3-Chlorophenyl)amino]carbonyl}-1,3,4-thiadiazol-2-yl)methoxy]acetic acid REF: 3D-FC119587CAS: 1142209-70-8 | Min. 95% | - - - | Discontinued product |

[(5-{[(3-chlorophenyl)amino]carbonyl}-1,3,4-thiadiazol-2-yl)methoxy]acetic acid
Ref: 10-F367780
1g | Discontinued | Request information | |
250mg | Discontinued | Request information |

[(5-{[(3-Chlorophenyl)amino]carbonyl}-1,3,4-thiadiazol-2-yl)methoxy]acetic acid
Ref: 3D-FC119587
1g | Discontinued | Request information | |
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |