CAS 1142209-70-8: 2-[[5-[[(3-Chlorophenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]methoxy]acetic acid

Description: 2-[[5-[[(3-Chlorophenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]methoxy]acetic acid is a chemical compound characterized by its complex structure, which includes a thiadiazole ring, a methoxy group, and an acetic acid moiety. The presence of the 3-chlorophenyl group contributes to its potential biological activity, as halogenated aromatic compounds often exhibit significant pharmacological properties. This compound is likely to be a polar molecule due to the presence of the carboxylic acid functional group, which can participate in hydrogen bonding, enhancing its solubility in polar solvents. The thiadiazole ring may impart unique reactivity and stability, making it of interest in medicinal chemistry. Additionally, the compound's structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties could be further explored through various analytical methods, including spectroscopy and chromatography, to determine its purity and structural integrity.

Formula: C₁₂H₁₀ClN₃O₄S

InChI: InChI=1S/C12H10ClN3O4S/c13-7-2-1-3-8(4-7)14-11(19)12-16-15-9(21-12)5-20-6-10(17)18/h1-4H,5-6H2,(H,14,19)(H,17,18)

InChI key: InChIKey=IXLLIDAXWRTFLG-UHFFFAOYSA-N

SMILES: O=C(O)COCC1=NN=C(S1)C(=O)NC=2C=CC=C(Cl)C2

Synonyms:

• 2-[[5-[[(3-Chlorophenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]methoxy]acetic acid
• Acetic acid, 2-[[5-[[(3-chlorophenyl)amino]carbonyl]-1,3,4-thiadiazol-2-yl]methoxy]-

[(5-{[(3-chlorophenyl)amino]carbonyl}-1,3,4-thiadiazol-2-yl)methoxy]acetic acid

CAS: 1142209-70-8

• Molecular weight: 327.739990234375

[(5-{[(3-Chlorophenyl)amino]carbonyl}-1,3,4-thiadiazol-2-yl)methoxy]acetic acid

CAS: 1142209-70-8

Please enquire for more information about [(5-{[(3-Chlorophenyl)amino]carbonyl}-1,3,4-thiadiazol-2-yl)methoxy]acetic acid including the price, delivery time and more …

• Formula: C₁₂H₁₀ClN₃O₄S
• Purity: Min. 95%
• Molecular weight: 327.74 g/mol