CAS 1142209-79-7
:1-[[3,5-Dimethyl-4-[(1-methylethoxy)carbonyl]-1H-pyrrol-2-yl]carbonyl]-4-piperidinecarboxylic acid
Description:
1-[[3,5-Dimethyl-4-[(1-methylethoxy)carbonyl]-1H-pyrrol-2-yl]carbonyl]-4-piperidinecarboxylic acid is a complex organic compound characterized by its multi-functional structure, which includes a pyrrole ring and a piperidine moiety. The presence of multiple methyl groups and an ethoxycarbonyl group contributes to its hydrophobic characteristics, while the carboxylic acid functional group imparts acidic properties. This compound is likely to exhibit moderate solubility in organic solvents and limited solubility in water due to its hydrophobic regions. Its molecular structure suggests potential biological activity, which may be explored in pharmaceutical applications. The compound's synthesis and reactivity can be influenced by the presence of the various functional groups, making it a candidate for further research in medicinal chemistry. Additionally, the compound's stability and reactivity may vary under different pH conditions, which is an important consideration for its potential applications. Overall, this substance represents a unique combination of structural features that may confer interesting chemical and biological properties.
Formula:C17H24N2O5
InChI:InChI=1S/C17H24N2O5/c1-9(2)24-17(23)13-10(3)14(18-11(13)4)15(20)19-7-5-12(6-8-19)16(21)22/h9,12,18H,5-8H2,1-4H3,(H,21,22)
InChI key:InChIKey=OBOAYGPJIMOIBN-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(C)C(C(OC(C)C)=O)=C(C)N1)N2CCC(C(O)=O)CC2
Synonyms:- 4-Piperidinecarboxylic acid, 1-[[3,5-dimethyl-4-[(1-methylethoxy)carbonyl]-1H-pyrrol-2-yl]carbonyl]-
- 1-[[3,5-Dimethyl-4-[(1-methylethoxy)carbonyl]-1H-pyrrol-2-yl]carbonyl]-4-piperidinecarboxylic acid
- 1-{[4-(isopropoxycarbonyl)-3,5-dimethyl-1H-pyrrol-2-yl]carbonyl}piperidine-4-carboxyl
- 4-piperidinecarboxylic acid, 1-[[3,5-dimethyl-4-[(1-methyl
- 1-{[4-(isopropoxycarbonyl)-3,5-dimethyl-1H-pyrrol-2-yl]carbonyl}piperidine-4-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.