CAS 1142209-88-8

1-(2-Chlorobenzoyl)-4-piperidineacetic acid

Description:

1-(2-Chlorobenzoyl)-4-piperidineacetic acid is a chemical compound characterized by its unique structure, which includes a piperidine ring and a chlorobenzoyl moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the chlorobenzoyl group may enhance lipophilicity, influencing its interaction with biological membranes and receptors. As a piperidine derivative, it may exhibit basic properties due to the nitrogen atom in the ring, which can participate in hydrogen bonding and protonation. The compound's potential applications could span various fields, including medicinal chemistry, where it may serve as a lead compound for drug development, particularly in targeting specific biological pathways. Its synthesis and characterization would involve standard organic chemistry techniques, and its stability, solubility, and reactivity would be influenced by the functional groups present. Overall, 1-(2-Chlorobenzoyl)-4-piperidineacetic acid represents a compound of interest for further research and development in pharmaceutical applications.

Formula: C₁₄H₁₆ClNO₃

InChI: InChI=1S/C14H16ClNO3/c15-12-4-2-1-3-11(12)14(19)16-7-5-10(6-8-16)9-13(17)18/h1-4,10H,5-9H2,(H,17,18)

InChI key: InChIKey=VYHKDHOWJOSDNQ-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(Cl)C=CC=C1)N2CCC(CC(O)=O)CC2

Synonyms:

• 4-Piperidineacetic acid, 1-(2-chlorobenzoyl)-
• 1-(2-Chlorobenzoyl)-4-piperidineacetic acid