CAS 1142209-94-6
:1-[(3,5-Dimethyl-1H-pyrrol-2-yl)carbonyl]-3-piperidinecarboxylic acid
Description:
1-[(3,5-Dimethyl-1H-pyrrol-2-yl)carbonyl]-3-piperidinecarboxylic acid is a chemical compound characterized by its unique structural features, which include a piperidine ring and a pyrrole moiety. The presence of the carbonyl group attached to the pyrrole indicates that it may exhibit significant reactivity, particularly in forming amides or other derivatives. This compound is likely to be a solid at room temperature, given its complex structure, and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid functional group. The dimethyl substitution on the pyrrole ring can influence its electronic properties, potentially enhancing its biological activity. Such compounds often find applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to their ability to interact with biological targets. Additionally, the presence of both a piperidine and a pyrrole suggests potential for diverse interactions, making it a candidate for further research in drug design and synthesis.
Formula:C13H18N2O3
InChI:InChI=1S/C13H18N2O3/c1-8-6-9(2)14-11(8)12(16)15-5-3-4-10(7-15)13(17)18/h6,10,14H,3-5,7H2,1-2H3,(H,17,18)
InChI key:InChIKey=LTUAQLZDZOZVEL-UHFFFAOYSA-N
SMILES:C(=O)(C=1NC(C)=CC1C)N2CC(C(O)=O)CCC2
Synonyms:- 3-Piperidinecarboxylic acid, 1-[(3,5-dimethyl-1H-pyrrol-2-yl)carbonyl]-
- 1-[(3,5-Dimethyl-1H-pyrrol-2-yl)carbonyl]-3-piperidinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.