CymitQuimica logo

CAS 1142209-97-9

:

1-[[5-(Ethoxycarbonyl)-2,4-dimethyl-1H-pyrrol-3-yl]carbonyl]-4-piperidineacetic acid

Description:
1-[[5-(Ethoxycarbonyl)-2,4-dimethyl-1H-pyrrol-3-yl]carbonyl]-4-piperidineacetic acid is a complex organic compound characterized by its unique structural features, which include a piperidine ring and a pyrrole moiety. The presence of ethoxycarbonyl and carbonyl functional groups suggests that it may exhibit significant reactivity, particularly in nucleophilic addition or condensation reactions. The compound's molecular structure indicates potential for biological activity, possibly serving as a pharmacophore in medicinal chemistry. Its solubility properties may vary depending on the solvent, influenced by the polar and non-polar regions within the molecule. Additionally, the presence of multiple functional groups may contribute to its ability to form hydrogen bonds, affecting its interaction with biological targets. The compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this substance may have applications in drug development or as a synthetic intermediate in organic synthesis, although specific biological or pharmacological properties would require further investigation.
Formula:C17H24N2O5
InChI:InChI=1S/C17H24N2O5/c1-4-24-17(23)15-10(2)14(11(3)18-15)16(22)19-7-5-12(6-8-19)9-13(20)21/h12,18H,4-9H2,1-3H3,(H,20,21)
InChI key:InChIKey=PSSFUZHPMXENQG-UHFFFAOYSA-N
SMILES:C(=O)(C=1C(C)=C(C(OCC)=O)NC1C)N2CCC(CC(O)=O)CC2
Synonyms:
  • 4-Piperidineacetic acid, 1-[[5-(ethoxycarbonyl)-2,4-dimethyl-1H-pyrrol-3-yl]carbonyl]-
  • 1-[[5-(Ethoxycarbonyl)-2,4-dimethyl-1H-pyrrol-3-yl]carbonyl]-4-piperidineacetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.